CAS 205048-79-9 is the registry number for NSC682769. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(3,4-dimethoxyphenyl)-2-phenyl-5,7-dihydropyrido[3,2-d][1]benzazepin-6-one (CAS 205048-79-9) is a chemical compound with the molecular formula C27H22N2O3 and a molecular weight of 422.5 g/mol. IUPAC name: 4-(3,4-dimethoxyphenyl)-2-phenyl-5,7-dihydropyrido[3,2-d][1]benzazepin-6-one. InChIKey: SGZJSYXKEGHHMW-UHFFFAOYSA-N.
| Molecular formula | C27H22N2O3 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 4-(3,4-dimethoxyphenyl)-2-phenyl-5,7-dihydropyrido[3,2-d][1]benzazepin-6-one |
| InChIKey | SGZJSYXKEGHHMW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NC3=C2CC(=O)NC4=CC=CC=C43)C5=CC=CC=C5)OC |
Computed by PubChem (NCBI)