CAS 205059-24-1 appears in our catalog under these names: 1-PIPERAZINECARBOXYLIC ACID, 4-(4-PIPER&, 1-Boc-4-(4-piperidinyl)-piperazine 95%, 1-Boc-4-(piperidin-4-yl)-piperazine, 95%, tert–Butyl 4–(piperidin–4–yl)piperazine–1–carboxylate, tert-Butyl 4-(Piperidin-4-yl)piperazine-1-carboxylate, >95.0%(HPLC)(T). Offered by: Sigma-Aldrich, Ambeed, Fluorochem, GLPBio, TCI. Available pack sizes: 100MG, 250mg, 1g, 5g, 25g, 100g, 2.5g, 10g.
Tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate (CAS 205059-24-1) is a chemical compound with the molecular formula C14H27N3O2 and a molecular weight of 269.38 g/mol. IUPAC name: tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate. InChIKey: IMFPSYLOYADSFR-UHFFFAOYSA-N.
| Molecular formula | C14H27N3O2 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate |
| InChIKey | IMFPSYLOYADSFR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2CCNCC2 |
Computed by PubChem (NCBI)