CAS 20507-95-3 is the registry number for rel-(4AS,8aR)-hexahydroquinazoline-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,8aR)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (CAS 20507-95-3) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: (4aS,8aR)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione. InChIKey: RHSYECGMHASHCW-NTSWFWBYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | (4aS,8aR)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| InChIKey | RHSYECGMHASHCW-NTSWFWBYSA-N |
| SMILES | C1CC[C@@H]2[C@H](C1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)