Products 205114-66-5
CAS 205114-66-5 is the registry number for Cimicifugic acid B. Offered by: MedChemExpress. Available pack sizes: 20 mg, 1 mg, 5 mg, 10 mg.
(2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxybutanedioic acid (CAS 205114-66-5) is a chemical compound with the molecular formula C21H20O11 and a molecular weight of 448.4 g/mol. IUPAC name: (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxybutanedioic acid. InChIKey: YVHLLZXSGPDXOA-ZHBFVYIWSA-N.
| Molecular formula | C21H20O11 |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-[(E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxybutanedioic acid |
| InChIKey | YVHLLZXSGPDXOA-ZHBFVYIWSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O[C@H](C(=O)O)[C@](CC2=CC(=C(C=C2)O)O)(C(=O)O)O)O |
Computed by PubChem (NCBI)