Products 20512-31-6
CAS 20512-31-6 is the registry number for Makisterone B. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
Makisterone B is a phytoecdysteroid, a 3beta-hydroxy steroid, a 26-hydroxy steroid, a 20-hydroxy steroid, a 2beta-hydroxy steroid, a 14alpha-hydroxy steroid, a 22-hydroxy steroid and a 6-oxo steroid.
Source: ChEBI
| Molecular formula | C28H46O7 |
|---|---|
| Molecular weight | 494.7 g/mol |
| IUPAC name | (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2R,3R,5R)-2,3,7-trihydroxy-5,6-dimethylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| InChIKey | ZJISPMMPECVLMY-CSUDGKPCSA-N |
| SMILES | C[C@H](C[C@H]([C@@](C)([C@H]1CC[C@@]2([C@@]1(CC[C@H]3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)C)O)O)O)C(C)CO |
Computed by PubChem (NCBI)