CAS 205127-59-9 is the registry number for Boc-L-Phe(4-CH2-N3)-OH. Offered by: Iris Biotech. Available pack sizes: on request.
(2S)-3-[4-(azidomethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205127-59-9) is a chemical compound with the molecular formula C15H20N4O4 and a molecular weight of 320.34 g/mol. IUPAC name: (2S)-3-[4-(azidomethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DMNMAHJEMCIRPE-LBPRGKRZSA-N.
| Molecular formula | C15H20N4O4 |
|---|---|
| Molecular weight | 320.34 g/mol |
| IUPAC name | (2S)-3-[4-(azidomethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DMNMAHJEMCIRPE-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)CN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)