CAS 205128-01-4 is the registry number for (1R,3S)-3-(Trifluoromethyl)cyclohexanol, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-ol (CAS 205128-01-4) is a chemical compound with the molecular formula C7H11F3O and a molecular weight of 168.16 g/mol. IUPAC name: cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-ol. InChIKey: WGZGFRDYYXKLRB-NTSWFWBYSA-N.
| Molecular formula | C7H11F3O |
|---|---|
| Molecular weight | 168.16 g/mol |
| IUPAC name | cis-(1R,3S)-3-(trifluoromethyl)cyclohexan-1-ol |
| InChIKey | WGZGFRDYYXKLRB-NTSWFWBYSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)O)C(F)(F)F |
Computed by PubChem (NCBI)