CAS 205187-77-5 is the registry number for 3-Fluorophenoxathiine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-fluorophenoxathiine (CAS 205187-77-5) is a chemical compound with the molecular formula C12H7FOS and a molecular weight of 218.25 g/mol. IUPAC name: 3-fluorophenoxathiine. InChIKey: CUKQYCCSGWUSNV-UHFFFAOYSA-N.
| Molecular formula | C12H7FOS |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-fluorophenoxathiine |
| InChIKey | CUKQYCCSGWUSNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC3=C(S2)C=CC(=C3)F |
Computed by PubChem (NCBI)