Products 2053-24-9
CAS 2053-24-9 is the registry number for Clonitazene HCl. Offered by: Supelco. Available pack sizes: 1ML.
2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride (CAS 2053-24-9) is a chemical compound with the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.3 g/mol. IUPAC name: 2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride. InChIKey: WNVYGSPFVRBKGS-UHFFFAOYSA-N.
| Molecular formula | C20H24Cl2N4O2 |
|---|---|
| Molecular weight | 423.3 g/mol |
| IUPAC name | 2-[2-[(4-chlorophenyl)methyl]-5-nitrobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride |
| InChIKey | WNVYGSPFVRBKGS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=C(C=C3)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Clonitazene hydrochloride