CAS 20536-50-9 is the registry number for (+)-2-Hydroxypinocamphone. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
(1R,2S,5R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one (CAS 20536-50-9) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: (1R,2S,5R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one. InChIKey: VZRRCQOUNSHSGB-XSSZXYGBSA-N.
| Molecular formula | C10H16O2 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | (1R,2S,5R)-2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one |
| InChIKey | VZRRCQOUNSHSGB-XSSZXYGBSA-N |
| SMILES | C[C@@]1([C@@H]2C[C@@H](C2(C)C)CC1=O)O |
Computed by PubChem (NCBI)