CAS 205391-02-2 appears in our catalog under these names: DAF-2 DA, DAF-2 DA, 98.00%, DAF-2 DA Solution, DAF-2DA, DAF 2DA (DAF–2DA). Offered by: TRC, Chemat, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: 25mg, 1mg, 5mg, 100ug, 250ug, 500ug, 100µg, 250µg.
(6'-acetyloxy-5,6-diamino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 205391-02-2) is a chemical compound with the molecular formula C24H18N2O7 and a molecular weight of 446.4 g/mol. IUPAC name: (6'-acetyloxy-5,6-diamino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: PTSUYDXEEKDBQU-UHFFFAOYSA-N.
| Molecular formula | C24H18N2O7 |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | (6'-acetyloxy-5,6-diamino-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | PTSUYDXEEKDBQU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC(=C(C=C5C(=O)O3)N)N |
Computed by PubChem (NCBI)