CAS 2054339-01-2 appears in our catalog under these names: Acid-apeg4-acid n-boc, 95%, N-Boc-N-bis(PEG2-acid), N–Boc–N–bis(PEG2–acid), N-Boc-N-bis(PEG2-acid), 95%, 95%, N-Boc-N-bis(PEG2-acid), 99.90%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 2mg, 500mg, 50mg, 5g, 100 mg.
3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid (CAS 2054339-01-2) is a chemical compound with the molecular formula C19H35NO10 and a molecular weight of 437.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid. InChIKey: BCKFXKJMBCVDJV-UHFFFAOYSA-N.
| Molecular formula | C19H35NO10 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]propanoic acid |
| InChIKey | BCKFXKJMBCVDJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCC(=O)O)CCOCCOCCC(=O)O |
Computed by PubChem (NCBI)