CAS 2054345-67-2 appears in our catalog under these names: Azido-tris(ethylenoxy)-l-alanine tfa salt, 95%, Azide–PEG3–C1–Ala, Azide-PEG3-C1-Ala. Offered by: Combi-blocks, GLPBio, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, Get quote.
(2R)-2-amino-3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoic acid (CAS 2054345-67-2) is a chemical compound with the molecular formula C9H18N4O5 and a molecular weight of 262.26 g/mol. IUPAC name: (2R)-2-amino-3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: BHNVZMHTTIZOKQ-MRVPVSSYSA-N.
| Molecular formula | C9H18N4O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | (2R)-2-amino-3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | BHNVZMHTTIZOKQ-MRVPVSSYSA-N |
| SMILES | C(COCCOCCOC[C@H](C(=O)O)N)N=[N+]=[N-] |
Computed by PubChem (NCBI)