CAS 2054859-47-9 is the registry number for 4,7-Dichloro-3-(trifluoromethyl)quinoline. Offered by: TRC. Available pack sizes: 100mg.
4,7-dichloro-3-(trifluoromethyl)quinoline (CAS 2054859-47-9) is a chemical compound with the molecular formula C10H4Cl2F3N and a molecular weight of 266.04 g/mol. IUPAC name: 4,7-dichloro-3-(trifluoromethyl)quinoline. InChIKey: WEZKVVWNCGYLNP-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2F3N |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 4,7-dichloro-3-(trifluoromethyl)quinoline |
| InChIKey | WEZKVVWNCGYLNP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1Cl)C(F)(F)F)Cl |
Computed by PubChem (NCBI)