Products 2054952-13-3
CAS 2054952-13-3 is the registry number for Vanin-1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]-thiophen-2-ylmethanone (CAS 2054952-13-3) is a chemical compound with the molecular formula C15H12N4OS and a molecular weight of 296.3 g/mol. IUPAC name: [2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]-thiophen-2-ylmethanone. InChIKey: XXQGGYNRNJTVTN-UHFFFAOYSA-N.
| Molecular formula | C15H12N4OS |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | [2-(pyridin-3-ylmethylamino)pyrimidin-5-yl]-thiophen-2-ylmethanone |
| InChIKey | XXQGGYNRNJTVTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC2=NC=C(C=N2)C(=O)C3=CC=CS3 |
Computed by PubChem (NCBI)