CAS 2055-94-9 appears in our catalog under these names: Levothyroxine Impurity 29, 4-(4-Hydroxy-3,5-diiodophenoxy)-3,5-diiodo-benzenemethanol, THYROXINE ALCOHOL. Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 25mg, 10MG.
4-[4-(hydroxymethyl)-2,6-diiodophenoxy]-2,6-diiodophenol (CAS 2055-94-9) is a chemical compound with the molecular formula C13H8I4O3 and a molecular weight of 719.82 g/mol. IUPAC name: 4-[4-(hydroxymethyl)-2,6-diiodophenoxy]-2,6-diiodophenol. InChIKey: JARDZLZAKYSQHG-UHFFFAOYSA-N.
| Molecular formula | C13H8I4O3 |
|---|---|
| Molecular weight | 719.82 g/mol |
| IUPAC name | 4-[4-(hydroxymethyl)-2,6-diiodophenoxy]-2,6-diiodophenol |
| InChIKey | JARDZLZAKYSQHG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)CO |
Computed by PubChem (NCBI)