CAS 2055013-55-1 appears in our catalog under these names: Ald-ph-peg6-acid, 95%, Ald-Ph-PEG6-acid, 97%, Ald-Ph-PEG6-acid, Ald–Ph–PEG6–acid, Ald-Ph-PEG6-acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 2mg, 5mg, 10mg, 1g, 1 g, 100 mg.
3-[2-[2-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055013-55-1) is a chemical compound with the molecular formula C23H35NO10 and a molecular weight of 485.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RNJVHKOJSNIKOU-UHFFFAOYSA-N.
| Molecular formula | C23H35NO10 |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RNJVHKOJSNIKOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)