Products 2055022-18-7
CAS 2055022-18-7 appears in our catalog under these names: Propargyl-peg10-acid, 95%, Propargyl–PEG10–acid, Propargyl-PEG10-acid 95%, Propargyl-PEG10-acid, 95%, 95%, Propargyl-PEG10-acid, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 500 mg, 50 mg, 100 mg.
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055022-18-7) is a chemical compound with the molecular formula C24H44O12 and a molecular weight of 524.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: ALHRCZLKCUZEQF-UHFFFAOYSA-N.
| Molecular formula | C24H44O12 |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | ALHRCZLKCUZEQF-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)