CAS 2055044-68-1 appears in our catalog under these names: T-Boc-n-amido-peg7-acid, 95%, Boc–NH–PEG7–acid, Boc-NH-PEG7-acid 95%, t-Boc-N-amido-PEG7-acid, 95%, 95%, Boc-NH-PEG7-acid, 99.76%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 250 mg, 1 g, 100 mg.
3-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055044-68-1) is a chemical compound with the molecular formula C22H43NO11 and a molecular weight of 497.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: NRLJITQFPLHTDR-UHFFFAOYSA-N.
| Molecular formula | C22H43NO11 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | NRLJITQFPLHTDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)