Products 205505-62-0
CAS 205505-62-0 appears in our catalog under these names: 5–Methoxyjusticidin A, 5-Methoxyjusticidin A. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
9-(1,3-benzodioxol-4-yl)-4,5,6,7-tetramethoxy-3H-benzo[f][2]benzofuran-1-one (CAS 205505-62-0) is a chemical compound with the molecular formula C23H20O8 and a molecular weight of 424.4 g/mol. IUPAC name: 9-(1,3-benzodioxol-4-yl)-4,5,6,7-tetramethoxy-3H-benzo[f][2]benzofuran-1-one. InChIKey: GGTZHSHHPAQZRU-UHFFFAOYSA-N.
| Molecular formula | C23H20O8 |
|---|---|
| Molecular weight | 424.4 g/mol |
| IUPAC name | 9-(1,3-benzodioxol-4-yl)-4,5,6,7-tetramethoxy-3H-benzo[f][2]benzofuran-1-one |
| InChIKey | GGTZHSHHPAQZRU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=C3C(=C2OC)COC3=O)C4=C5C(=CC=C4)OCO5)OC)OC |
Computed by PubChem (NCBI)