CAS 2055098-76-3 is the registry number for Rel-((2R,3R)-2-cyclohexylpyrrolidin-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-2-cyclohexylpyrrolidin-3-yl]methanol (CAS 2055098-76-3) is a chemical compound with the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. IUPAC name: [(2R,3R)-2-cyclohexylpyrrolidin-3-yl]methanol. InChIKey: GRBGZHPLECYKAD-WDEREUQCSA-N.
| Molecular formula | C11H21NO |
|---|---|
| Molecular weight | 183.29 g/mol |
| IUPAC name | [(2R,3R)-2-cyclohexylpyrrolidin-3-yl]methanol |
| InChIKey | GRBGZHPLECYKAD-WDEREUQCSA-N |
| SMILES | C1CCC(CC1)[C@@H]2[C@@H](CCN2)CO |
Computed by PubChem (NCBI)