CAS 2055113-57-8 is the registry number for 1-Cyclopropylcarbonyl-piperazine-d8. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
Cyclopropyl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone (CAS 2055113-57-8) is a chemical compound with the molecular formula C8H14N2O and a molecular weight of 162.26 g/mol. IUPAC name: cyclopropyl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone. InChIKey: KIALFUYSJAAJSU-SQUIKQQTSA-N.
| Molecular formula | C8H14N2O |
|---|---|
| Molecular weight | 162.26 g/mol |
| IUPAC name | cyclopropyl-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)methanone |
| InChIKey | KIALFUYSJAAJSU-SQUIKQQTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)C2CC2)([2H])[2H])[2H] |
Computed by PubChem (NCBI)