CAS 2055119-07-6 is the registry number for Methyl 2-cyano-2-(2,3-difluoro-6-nitrophenyl)acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-cyano-2-(2,3-difluoro-6-nitrophenyl)acetate (CAS 2055119-07-6) is a chemical compound with the molecular formula C10H6F2N2O4 and a molecular weight of 256.16 g/mol. IUPAC name: methyl 2-cyano-2-(2,3-difluoro-6-nitrophenyl)acetate. InChIKey: ITFLRTXKXIZFFA-UHFFFAOYSA-N.
| Molecular formula | C10H6F2N2O4 |
|---|---|
| Molecular weight | 256.16 g/mol |
| IUPAC name | methyl 2-cyano-2-(2,3-difluoro-6-nitrophenyl)acetate |
| InChIKey | ITFLRTXKXIZFFA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=C(C=CC(=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)