CAS 2055119-16-7 is the registry number for 2-Amino-7-nitro-1,3-benzoxazole-5-sulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-amino-7-nitro-1,3-benzoxazole-5-sulfonic acid (CAS 2055119-16-7) is a chemical compound with the molecular formula C7H5N3O6S and a molecular weight of 259.20 g/mol. IUPAC name: 2-amino-7-nitro-1,3-benzoxazole-5-sulfonic acid. InChIKey: WLJYOPBQYDHTQM-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O6S |
|---|---|
| Molecular weight | 259.20 g/mol |
| IUPAC name | 2-amino-7-nitro-1,3-benzoxazole-5-sulfonic acid |
| InChIKey | WLJYOPBQYDHTQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)N)[N+](=O)[O-])S(=O)(=O)O |
Computed by PubChem (NCBI)