CAS 2055119-26-9 is the registry number for N'-[(tert-Butoxy)carbonyl]-2-chloro-4-nitrobenzohydrazide, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(2-chloro-4-nitrobenzoyl)amino]carbamate (CAS 2055119-26-9) is a chemical compound with the molecular formula C12H14ClN3O5 and a molecular weight of 315.71 g/mol. IUPAC name: tert-butyl N-[(2-chloro-4-nitrobenzoyl)amino]carbamate. InChIKey: JJBCYAJXTHAVOL-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O5 |
|---|---|
| Molecular weight | 315.71 g/mol |
| IUPAC name | tert-butyl N-[(2-chloro-4-nitrobenzoyl)amino]carbamate |
| InChIKey | JJBCYAJXTHAVOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)