CAS 2055119-37-2 is the registry number for Methyl 3,4-dimethanesulfonylbenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3,4-bis(methylsulfonyl)benzoate (CAS 2055119-37-2) is a chemical compound with the molecular formula C10H12O6S2 and a molecular weight of 292.3 g/mol. IUPAC name: methyl 3,4-bis(methylsulfonyl)benzoate. InChIKey: BTENMFGJJVWDOY-UHFFFAOYSA-N.
| Molecular formula | C10H12O6S2 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | methyl 3,4-bis(methylsulfonyl)benzoate |
| InChIKey | BTENMFGJJVWDOY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)S(=O)(=O)C)S(=O)(=O)C |
Computed by PubChem (NCBI)