CAS 2055156-69-7 is the registry number for Potassium 2,3-dihydro-1-benzofuran-5-yltrifluoroboranuide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Potassium 2,3-dihydro-1-benzofuran-5-yl(trifluoro)boranuide (CAS 2055156-69-7) is a chemical compound with the molecular formula C8H7BF3KO and a molecular weight of 226.05 g/mol. IUPAC name: potassium 2,3-dihydro-1-benzofuran-5-yl(trifluoro)boranuide. InChIKey: BZUZHKKIBWWHFK-UHFFFAOYSA-N.
| Molecular formula | C8H7BF3KO |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | potassium 2,3-dihydro-1-benzofuran-5-yl(trifluoro)boranuide |
| InChIKey | BZUZHKKIBWWHFK-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC2=C(C=C1)OCC2)(F)(F)F.[K+] |
Computed by PubChem (NCBI)