CAS 2055353-75-6 appears in our catalog under these names: Mal–amido–PEG3–acid, Mal-amido-PEG3-acid 98%, 1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid, 98%, 98%, Mal-amido-PEG3-acid, 98.0%, 1-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13-trioxa-4-azahexadecan-16-oic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 250 mg, 1 g, 100 mg, 50 mg.
3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2055353-75-6) is a chemical compound with the molecular formula C16H24N2O8 and a molecular weight of 372.37 g/mol. IUPAC name: 3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: VRSINYAEWCLYBF-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O8 |
|---|---|
| Molecular weight | 372.37 g/mol |
| IUPAC name | 3-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | VRSINYAEWCLYBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)