CAS 2055397-18-5 appears in our catalog under these names: WM–8014, Moz-in-3, 95%, WM-8014/ 99.95% (existing batch purity), WM 8014, WM-8014 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 100mg, 1mg, 2mg, 10mg, 25mg, 50mg, 10mM/1mL.
N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-phenylbenzohydrazide (CAS 2055397-18-5) is a chemical compound with the molecular formula C20H17FN2O3S and a molecular weight of 384.4 g/mol. IUPAC name: N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-phenylbenzohydrazide. InChIKey: PHHZKBMVRPULAW-UHFFFAOYSA-N.
| Molecular formula | C20H17FN2O3S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | N'-(benzenesulfonyl)-2-fluoro-3-methyl-5-phenylbenzohydrazide |
| InChIKey | PHHZKBMVRPULAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C(=O)NNS(=O)(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)