Products 2055466-64-1
CAS 2055466-64-1 is the registry number for Des(5-(2-dimethylamino)ethyl) Diltiazem 5-Ethenyl. Offered by: TRC. Available pack sizes: 25mg.
[(2S,3S)-5-ethenyl-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (CAS 2055466-64-1) is a chemical compound with the molecular formula C20H19NO4S and a molecular weight of 369.4 g/mol. IUPAC name: [(2S,3S)-5-ethenyl-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate. InChIKey: FGTNSKZTULGDDS-MOPGFXCFSA-N.
| Molecular formula | C20H19NO4S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | [(2S,3S)-5-ethenyl-2-(4-methoxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| InChIKey | FGTNSKZTULGDDS-MOPGFXCFSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)C=C)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)