Products 2055601-24-4
CAS 2055601-24-4 is the registry number for P2X4 antagonist-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide (CAS 2055601-24-4) is a chemical compound with the molecular formula C21H16ClF3N2O4S and a molecular weight of 484.9 g/mol. IUPAC name: N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide. InChIKey: CMFKVCGCNOSZAL-UHFFFAOYSA-N.
| Molecular formula | C21H16ClF3N2O4S |
|---|---|
| Molecular weight | 484.9 g/mol |
| IUPAC name | N-[4-(3-chlorophenoxy)-3-sulfamoylphenyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | CMFKVCGCNOSZAL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=CC(=C(C=C2)OC3=CC(=CC=C3)Cl)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)