CAS 2055779-20-7 appears in our catalog under these names: 4-Iodo-5-(methoxycarbonyl)isothiazole-3-carboxylic acid, 97%, 4-Iodo-5-(methoxycarbonyl)-1,2-thiazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
4-iodo-5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid (CAS 2055779-20-7) is a chemical compound with the molecular formula C6H4INO4S and a molecular weight of 313.07 g/mol. IUPAC name: 4-iodo-5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid. InChIKey: ZVLBPQKFJTWDJT-UHFFFAOYSA-N.
| Molecular formula | C6H4INO4S |
|---|---|
| Molecular weight | 313.07 g/mol |
| IUPAC name | 4-iodo-5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid |
| InChIKey | ZVLBPQKFJTWDJT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NS1)C(=O)O)I |
Computed by PubChem (NCBI)