CAS 2055787-31-8 is the registry number for Celecoxib Impurity 55. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
4-[5-(4-formylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CAS 2055787-31-8) is a chemical compound with the molecular formula C17H12F3N3O3S and a molecular weight of 395.4 g/mol. IUPAC name: 4-[5-(4-formylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide. InChIKey: DUBHJZUGZBQQGF-UHFFFAOYSA-N.
| Molecular formula | C17H12F3N3O3S |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 4-[5-(4-formylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChIKey | DUBHJZUGZBQQGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)