CAS 2055829-99-5 is the registry number for 1-(Difluoromethyl)-4-(((1,1-dimethylethyl)dimethylsilyl)oxy)benzene. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl-[4-(difluoromethyl)phenoxy]-dimethylsilane (CAS 2055829-99-5) is a chemical compound with the molecular formula C13H20F2OSi and a molecular weight of 258.38 g/mol. IUPAC name: tert-butyl-[4-(difluoromethyl)phenoxy]-dimethylsilane. InChIKey: QGOUIBCAARUQPT-UHFFFAOYSA-N.
| Molecular formula | C13H20F2OSi |
|---|---|
| Molecular weight | 258.38 g/mol |
| IUPAC name | tert-butyl-[4-(difluoromethyl)phenoxy]-dimethylsilane |
| InChIKey | QGOUIBCAARUQPT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C(F)F |
Computed by PubChem (NCBI)