CAS 2055841-09-1 is the registry number for (1S,2R)-Rel-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine (CAS 2055841-09-1) is a chemical compound with the molecular formula C11H14FNO and a molecular weight of 195.23 g/mol. IUPAC name: trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine. InChIKey: UNMOZWVGBVZHOR-SCZZXKLOSA-N.
| Molecular formula | C11H14FNO |
|---|---|
| Molecular weight | 195.23 g/mol |
| IUPAC name | trans-(1S,2R)-2-(3-ethoxy-4-fluorophenyl)cyclopropan-1-amine |
| InChIKey | UNMOZWVGBVZHOR-SCZZXKLOSA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@H]2C[C@@H]2N)F |
Computed by PubChem (NCBI)