CAS 2055841-17-1 is the registry number for (2-Methyl-2h-indazol-5-yl)methanamine hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Bis((2-methylindazol-5-yl)methanamine);oxalic acid (CAS 2055841-17-1) is a chemical compound with the molecular formula C20H24N6O4 and a molecular weight of 412.4 g/mol. IUPAC name: bis((2-methylindazol-5-yl)methanamine);oxalic acid. InChIKey: WTVUUKVAZXHVTF-UHFFFAOYSA-N.
| Molecular formula | C20H24N6O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | bis((2-methylindazol-5-yl)methanamine);oxalic acid |
| InChIKey | WTVUUKVAZXHVTF-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=C(C=CC2=N1)CN.CN1C=C2C=C(C=CC2=N1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)