CAS 2055849-17-5 appears in our catalog under these names: (R)-3,3-Difluoro-8-azaspiro[4.5]decan-1-amine dihydrochloride, 95%, (R)-3,3-Difluoro-8-azaspiro(4.5)decan-1-amine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g.
(4R)-2,2-difluoro-8-azaspiro[4.5]decan-4-amine;dihydrochloride (CAS 2055849-17-5) is a chemical compound with the molecular formula C9H18Cl2F2N2 and a molecular weight of 263.15 g/mol. IUPAC name: (4R)-2,2-difluoro-8-azaspiro[4.5]decan-4-amine;dihydrochloride. InChIKey: PRUFFCHQYARBSX-XCUBXKJBSA-N.
| Molecular formula | C9H18Cl2F2N2 |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | (4R)-2,2-difluoro-8-azaspiro[4.5]decan-4-amine;dihydrochloride |
| InChIKey | PRUFFCHQYARBSX-XCUBXKJBSA-N |
| SMILES | C1CNCCC12CC(C[C@H]2N)(F)F.Cl.Cl |
Computed by PubChem (NCBI)