CAS 2055901-03-4 is the registry number for PDE2A-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,6-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]pyrazolo[3,4-d]pyrimidin-4-amine (CAS 2055901-03-4) is a chemical compound with the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. IUPAC name: 1,6-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: XBYSLZZQMIGOEQ-UHFFFAOYSA-N.
| Molecular formula | C17H16F3N5 |
|---|---|
| Molecular weight | 347.34 g/mol |
| IUPAC name | 1,6-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]cyclopropyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | XBYSLZZQMIGOEQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C2C=NN(C2=N1)C)NC3(CC3)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)