CAS 2056002-39-0 is the registry number for SHP2-IN-40. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-yl]sulfanyl-3-chloropyridin-2-amine (CAS 2056002-39-0) is a chemical compound with the molecular formula C16H21ClN6S and a molecular weight of 364.9 g/mol. IUPAC name: 4-[5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-yl]sulfanyl-3-chloropyridin-2-amine. InChIKey: SBOLUTKFXHBIHM-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN6S |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 4-[5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-yl]sulfanyl-3-chloropyridin-2-amine |
| InChIKey | SBOLUTKFXHBIHM-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CN=C(C=N2)SC3=C(C(=NC=C3)N)Cl)CN |
Computed by PubChem (NCBI)