Products 2056111-45-4
CAS 2056111-45-4 appears in our catalog under these names: 4-(2-Amino-5-(4-cyanophenyl)pyridin-3-yl)-N-isopropylbenzamide, 98%, PF-794, 99.19%. Offered by: Chemat, BLDpharm, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 10 mg, 50 mg, 25 mg, 5 mg.
4-[2-amino-5-(4-cyanophenyl)-3-pyridinyl]-N-propan-2-ylbenzamide (CAS 2056111-45-4) is a chemical compound with the molecular formula C22H20N4O and a molecular weight of 356.4 g/mol. IUPAC name: 4-[2-amino-5-(4-cyanophenyl)-3-pyridinyl]-N-propan-2-ylbenzamide. InChIKey: MZPZXXQVQMSLIP-UHFFFAOYSA-N.
| Molecular formula | C22H20N4O |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 4-[2-amino-5-(4-cyanophenyl)-3-pyridinyl]-N-propan-2-ylbenzamide |
| InChIKey | MZPZXXQVQMSLIP-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C=C1)C2=C(N=CC(=C2)C3=CC=C(C=C3)C#N)N |
Computed by PubChem (NCBI)