CAS 2056262-08-7 appears in our catalog under these names: (R)-BRD3731, 98%, (R)–BRD3731, (R)-BRD3731, 98.22%, 98.22%, (R)-BRD3731, 98.22%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 50mg, 1mg, 10mM/1mL, 10 mg, 100 mg.
(4R)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (CAS 2056262-08-7) is a chemical compound with the molecular formula C24H31N3O and a molecular weight of 377.5 g/mol. IUPAC name: (4R)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one. InChIKey: YZRXTIGAQRIAEX-DEOSSOPVSA-N.
| Molecular formula | C24H31N3O |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | (4R)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| InChIKey | YZRXTIGAQRIAEX-DEOSSOPVSA-N |
| SMILES | C[C@@]1(C2=C(CC(CC2=O)(C)C)NC3=NNC(=C31)CC(C)(C)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)