CAS 2056262-07-6 appears in our catalog under these names: BRD3731, 98%, BRD3731, BRD3731 98%, BRD3731, 98%, 98%, BRD3731, 98.18%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 1mg, 100 mg.
(4S)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one (CAS 2056262-07-6) is a chemical compound with the molecular formula C24H31N3O and a molecular weight of 377.5 g/mol. IUPAC name: (4S)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one. InChIKey: YZRXTIGAQRIAEX-XMMPIXPASA-N.
| Molecular formula | C24H31N3O |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | (4S)-3-(2,2-dimethylpropyl)-4,7,7-trimethyl-4-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| InChIKey | YZRXTIGAQRIAEX-XMMPIXPASA-N |
| SMILES | C[C@]1(C2=C(CC(CC2=O)(C)C)NC3=NNC(=C31)CC(C)(C)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)