CAS 205650-69-7 appears in our catalog under these names: Fipronil Amide, >95% (HPLC), Fipronil-carboxamide, Fipronil-carboxamide 100 µg/mL in Acetonitrile, Fipronil carboxamide, Fipronil carboxamide, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 50mg, 5mg, 10mg, 1ml, 1x10mg, 1x1ml.
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazole-3-carboxamide (CAS 205650-69-7) is a chemical compound with the molecular formula C12H6Cl2F6N4O2S and a molecular weight of 455.2 g/mol. IUPAC name: 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazole-3-carboxamide. InChIKey: OPPWTDFHAFPGOT-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2F6N4O2S |
|---|---|
| Molecular weight | 455.2 g/mol |
| IUPAC name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazole-3-carboxamide |
| InChIKey | OPPWTDFHAFPGOT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C(=O)N)S(=O)C(F)(F)F)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)