CAS 2056937-95-0 appears in our catalog under these names: 2,4-Dichloro-5-iodo-7-(oxetan-3-yl)-7H-pyrrolo[2,3-d]pyrimidine, 95%, 95%, 2,4-Dichloro-5-iodo-7-(oxetan-3-yl)-7H-pyrrolo[2,3-d]pyrimidine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-5-iodo-7-(oxetan-3-yl)pyrrolo[2,3-d]pyrimidine (CAS 2056937-95-0) is a chemical compound with the molecular formula C9H6Cl2IN3O and a molecular weight of 369.97 g/mol. IUPAC name: 2,4-dichloro-5-iodo-7-(oxetan-3-yl)pyrrolo[2,3-d]pyrimidine. InChIKey: PJZFPBSDHQTQIK-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2IN3O |
|---|---|
| Molecular weight | 369.97 g/mol |
| IUPAC name | 2,4-dichloro-5-iodo-7-(oxetan-3-yl)pyrrolo[2,3-d]pyrimidine |
| InChIKey | PJZFPBSDHQTQIK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)N2C=C(C3=C2N=C(N=C3Cl)Cl)I |
Computed by PubChem (NCBI)