CAS 2057-25-2 appears in our catalog under these names: 2-((3R,6R)-1,6-Dimethylpiperidin-3-yl)propan-2-ol, Tranexamic Acid Impurity 5. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
2-[(3R,6R)-1,6-dimethylpiperidin-3-yl]propan-2-ol (CAS 2057-25-2) is a chemical compound with the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. IUPAC name: 2-[(3R,6R)-1,6-dimethylpiperidin-3-yl]propan-2-ol. InChIKey: UDOOXYSCJOAAHF-RKDXNWHRSA-N.
| Molecular formula | C10H21NO |
|---|---|
| Molecular weight | 171.28 g/mol |
| IUPAC name | 2-[(3R,6R)-1,6-dimethylpiperidin-3-yl]propan-2-ol |
| InChIKey | UDOOXYSCJOAAHF-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1C)C(C)(C)O |
Computed by PubChem (NCBI)