CAS 205755-86-8 is the registry number for rac 6-Chloro-1,4-dihydro-4-(1-pentynyl)-4-(trifluoromethyl)-2H-3,1-benzoxazin-2-one, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
6-chloro-4-pent-1-ynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 205755-86-8) is a chemical compound with the molecular formula C14H11ClF3NO2 and a molecular weight of 317.69 g/mol. IUPAC name: 6-chloro-4-pent-1-ynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: RNMIPUHUAVCLHQ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClF3NO2 |
|---|---|
| Molecular weight | 317.69 g/mol |
| IUPAC name | 6-chloro-4-pent-1-ynyl-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | RNMIPUHUAVCLHQ-UHFFFAOYSA-N |
| SMILES | CCCC#CC1(C2=C(C=CC(=C2)Cl)NC(=O)O1)C(F)(F)F |
Computed by PubChem (NCBI)