CAS 205756-59-8 is the registry number for Methyl 1-((triisopropylsilyl)oxy)cyclopropane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-tri(propan-2-yl)silyloxycyclopropane-1-carboxylate (CAS 205756-59-8) is a chemical compound with the molecular formula C14H28O3Si and a molecular weight of 272.45 g/mol. IUPAC name: methyl 1-tri(propan-2-yl)silyloxycyclopropane-1-carboxylate. InChIKey: GKGFNEIHUOXMRH-UHFFFAOYSA-N.
| Molecular formula | C14H28O3Si |
|---|---|
| Molecular weight | 272.45 g/mol |
| IUPAC name | methyl 1-tri(propan-2-yl)silyloxycyclopropane-1-carboxylate |
| InChIKey | GKGFNEIHUOXMRH-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OC1(CC1)C(=O)OC |
Computed by PubChem (NCBI)