CAS 205760-35-6 appears in our catalog under these names: 2-(4-Hydroxyphenoxy)propionic acid potassium salt, 95%, Potassium 2-(4-hydroxyphenoxy)propionate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g, 250g.
Potassium 2-(4-hydroxyphenoxy)propanoate (CAS 205760-35-6) is a chemical compound with the molecular formula C9H9KO4 and a molecular weight of 220.26 g/mol. IUPAC name: potassium 2-(4-hydroxyphenoxy)propanoate. InChIKey: RHWBAORFZYOJII-UHFFFAOYSA-M.
| Molecular formula | C9H9KO4 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | potassium 2-(4-hydroxyphenoxy)propanoate |
| InChIKey | RHWBAORFZYOJII-UHFFFAOYSA-M |
| SMILES | CC(C(=O)[O-])OC1=CC=C(C=C1)O.[K+] |
Computed by PubChem (NCBI)