CAS 2058426-46-1 is the registry number for 3-[2,5-Dioxo-1-(3,4,5-trifluorophenyl)imidazolidin-4-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[2,5-dioxo-1-(3,4,5-trifluorophenyl)imidazolidin-4-yl]propanoic acid (CAS 2058426-46-1) is a chemical compound with the molecular formula C12H9F3N2O4 and a molecular weight of 302.21 g/mol. IUPAC name: 3-[2,5-dioxo-1-(3,4,5-trifluorophenyl)imidazolidin-4-yl]propanoic acid. InChIKey: YZPGPQOKYIZYTR-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O4 |
|---|---|
| Molecular weight | 302.21 g/mol |
| IUPAC name | 3-[2,5-dioxo-1-(3,4,5-trifluorophenyl)imidazolidin-4-yl]propanoic acid |
| InChIKey | YZPGPQOKYIZYTR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)N2C(=O)C(NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)