CAS 20590-58-3 is the registry number for 3-Amino-3-deoxy-D-ribose, hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 50mg.
(2R,3R,4S)-3-amino-2,4,5-trihydroxypentanal;hydrochloride (CAS 20590-58-3) is a chemical compound with the molecular formula C5H12ClNO4 and a molecular weight of 185.60 g/mol. IUPAC name: (2R,3R,4S)-3-amino-2,4,5-trihydroxypentanal;hydrochloride. InChIKey: VQCNVYRCFSZCEQ-VEGRVEBRSA-N.
| Molecular formula | C5H12ClNO4 |
|---|---|
| Molecular weight | 185.60 g/mol |
| IUPAC name | (2R,3R,4S)-3-amino-2,4,5-trihydroxypentanal;hydrochloride |
| InChIKey | VQCNVYRCFSZCEQ-VEGRVEBRSA-N |
| SMILES | C([C@H]([C@H]([C@H](C=O)O)N)O)O.Cl |
Computed by PubChem (NCBI)